About ethene;9H-fluorene
ethene;9H-fluorene (PubChem CID 159544077) has the molecular formula C15H14
and a molecular weight of 194.28 g/mol. Its IUPAC name is ethene;9H-fluorene.
Molecular Properties
| Compound Name | ethene;9H-fluorene |
| PubChem CID | 159544077 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | ethene;9H-fluorene |
| SMILES | C=C.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C2H4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2/h1-8H,9H2;1-2H2 |
| InChIKey | MEOPJXNUOJPKKX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;9H-fluorene?
The IUPAC name of ethene;9H-fluorene (CID 159544077) is ethene;9H-fluorene.
What is the SMILES notation for ethene;9H-fluorene?
The canonical SMILES for ethene;9H-fluorene is C=C.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of ethene;9H-fluorene?
The InChIKey is MEOPJXNUOJPKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C2H4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2/h1-8H,9H2;1-2H2.
What are the key properties of ethene;9H-fluorene?
ethene;9H-fluorene has a molecular weight of 194.28 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;9H-fluorene is sourced from PubChem (CID 159544077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).