About azane;9H-fluorene;hydrobromide
azane;9H-fluorene;hydrobromide (PubChem CID 174352852) has the molecular formula C13H14BrN
and a molecular weight of 264.17 g/mol. Its IUPAC name is azane;9H-fluorene;hydrobromide.
Molecular Properties
| Compound Name | azane;9H-fluorene;hydrobromide |
| PubChem CID | 174352852 |
| Molecular Formula | C13H14BrN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | azane;9H-fluorene;hydrobromide |
| SMILES | Br.N.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.BrH.H3N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;/h1-8H,9H2;1H;1H3 |
| InChIKey | YGGRUMUUOFAHNO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;9H-fluorene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;9H-fluorene;hydrobromide?
The IUPAC name of azane;9H-fluorene;hydrobromide (CID 174352852) is azane;9H-fluorene;hydrobromide.
What is the SMILES notation for azane;9H-fluorene;hydrobromide?
The canonical SMILES for azane;9H-fluorene;hydrobromide is Br.N.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of azane;9H-fluorene;hydrobromide?
The InChIKey is YGGRUMUUOFAHNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.BrH.H3N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;/h1-8H,9H2;1H;1H3.
What are the key properties of azane;9H-fluorene;hydrobromide?
azane;9H-fluorene;hydrobromide has a molecular weight of 264.17 g/mol, XLogP of 4.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;9H-fluorene;hydrobromide is sourced from PubChem (CID 174352852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).