About dichlorotitanium;9H-fluorene
dichlorotitanium;9H-fluorene (PubChem CID 174396064) has the molecular formula C13H10Cl2Ti
and a molecular weight of 285.00 g/mol. Its IUPAC name is dichlorotitanium;9H-fluorene.
Molecular Properties
| Compound Name | dichlorotitanium;9H-fluorene |
| PubChem CID | 174396064 |
| Molecular Formula | C13H10Cl2Ti |
| Molecular Weight | 285.00 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | dichlorotitanium;9H-fluorene |
| SMILES | Cl[Ti]Cl.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.2ClH.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;;/h1-8H,9H2;2*1H;/q;;;+2/p-2 |
| InChIKey | OSIUEFCLEOHNKJ-UHFFFAOYSA-L |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.00 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorotitanium;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;9H-fluorene?
The IUPAC name of dichlorotitanium;9H-fluorene (CID 174396064) is dichlorotitanium;9H-fluorene.
What is the SMILES notation for dichlorotitanium;9H-fluorene?
The canonical SMILES for dichlorotitanium;9H-fluorene is Cl[Ti]Cl.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of dichlorotitanium;9H-fluorene?
The InChIKey is OSIUEFCLEOHNKJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H10.2ClH.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;;/h1-8H,9H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorotitanium;9H-fluorene?
dichlorotitanium;9H-fluorene has a molecular weight of 285.00 g/mol, XLogP of 4.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;9H-fluorene is sourced from PubChem (CID 174396064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).