About carbon dioxide;9H-fluorene;methane
carbon dioxide;9H-fluorene;methane (PubChem CID 158285860) has the molecular formula C15H14O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is carbon dioxide;9H-fluorene;methane.
Molecular Properties
| Compound Name | carbon dioxide;9H-fluorene;methane |
| PubChem CID | 158285860 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | carbon dioxide;9H-fluorene;methane |
| SMILES | C.O=C=O.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.CO2.CH4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2-1-3;/h1-8H,9H2;;1H4 |
| InChIKey | GKTSNKVHMSAYEJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbon dioxide;9H-fluorene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;9H-fluorene;methane?
The IUPAC name of carbon dioxide;9H-fluorene;methane (CID 158285860) is carbon dioxide;9H-fluorene;methane.
What is the SMILES notation for carbon dioxide;9H-fluorene;methane?
The canonical SMILES for carbon dioxide;9H-fluorene;methane is C.O=C=O.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of carbon dioxide;9H-fluorene;methane?
The InChIKey is GKTSNKVHMSAYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.CO2.CH4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2-1-3;/h1-8H,9H2;;1H4.
What are the key properties of carbon dioxide;9H-fluorene;methane?
carbon dioxide;9H-fluorene;methane has a molecular weight of 226.28 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;9H-fluorene;methane is sourced from PubChem (CID 158285860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).