carbon dioxide;9H-fluorene;methane

C15H14O2 — CID 158285860

IUPACcarbon dioxide;9H-fluorene;methane
SMILESC.O=C=O.c1ccc2c(c1)Cc1ccccc1-2
InChIInChI=1S/C13H10.CO2.CH4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2-1-3;/h1-8H,9H2;;1H4
InChIKeyGKTSNKVHMSAYEJ-UHFFFAOYSA-N
MW226.28 g/mol
LogP3.31
Rot. Bonds

About carbon dioxide;9H-fluorene;methane

carbon dioxide;9H-fluorene;methane (PubChem CID 158285860) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is carbon dioxide;9H-fluorene;methane.

Molecular Properties

Compound Namecarbon dioxide;9H-fluorene;methane
PubChem CID158285860
Molecular FormulaC15H14O2
Molecular Weight226.28 g/mol
Exact Mass226.10
IUPAC Namecarbon dioxide;9H-fluorene;methane
SMILESC.O=C=O.c1ccc2c(c1)Cc1ccccc1-2
InChIInChI=1S/C13H10.CO2.CH4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2-1-3;/h1-8H,9H2;;1H4
InChIKeyGKTSNKVHMSAYEJ-UHFFFAOYSA-N
XLogP3.31
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.28
LogP ≤ 53.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze carbon dioxide;9H-fluorene;methane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;9H-fluorene;methane?
The IUPAC name of carbon dioxide;9H-fluorene;methane (CID 158285860) is carbon dioxide;9H-fluorene;methane.
What is the SMILES notation for carbon dioxide;9H-fluorene;methane?
The canonical SMILES for carbon dioxide;9H-fluorene;methane is C.O=C=O.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of carbon dioxide;9H-fluorene;methane?
The InChIKey is GKTSNKVHMSAYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.CO2.CH4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2-1-3;/h1-8H,9H2;;1H4.
What are the key properties of carbon dioxide;9H-fluorene;methane?
carbon dioxide;9H-fluorene;methane has a molecular weight of 226.28 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;9H-fluorene;methane is sourced from PubChem (CID 158285860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).