C15H10O2 — CID 606622
tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-9,10-dione (PubChem CID 606622) has the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. Its IUPAC name is tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-9,10-dione.
| Compound Name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-9,10-dione |
|---|---|
| PubChem CID | 606622 |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-9,10-dione |
| SMILES | O=C1C(=O)c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C15H10O2/c16-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15(14)17/h1-8H,9H2 |
| InChIKey | DWRUFPXHVGCWQI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|