About 10H-anthracen-9-one;ethane;methanol
10H-anthracen-9-one;ethane;methanol (PubChem CID 90976205) has the molecular formula C17H20O2
and a molecular weight of 256.34 g/mol. Its IUPAC name is 10H-anthracen-9-one;ethane;methanol.
Molecular Properties
| Compound Name | 10H-anthracen-9-one;ethane;methanol |
| PubChem CID | 90976205 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 10H-anthracen-9-one;ethane;methanol |
| SMILES | CC.CO.O=C1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C14H10O.C2H6.CH4O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;2*1-2/h1-8H,9H2;1-2H3;2H,1H3 |
| InChIKey | GCXNOPKPRBIIPC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10H-anthracen-9-one;ethane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-anthracen-9-one;ethane;methanol?
The IUPAC name of 10H-anthracen-9-one;ethane;methanol (CID 90976205) is 10H-anthracen-9-one;ethane;methanol.
What is the SMILES notation for 10H-anthracen-9-one;ethane;methanol?
The canonical SMILES for 10H-anthracen-9-one;ethane;methanol is CC.CO.O=C1c2ccccc2Cc2ccccc21.
What is the InChIKey of 10H-anthracen-9-one;ethane;methanol?
The InChIKey is GCXNOPKPRBIIPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O.C2H6.CH4O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;2*1-2/h1-8H,9H2;1-2H3;2H,1H3.
What are the key properties of 10H-anthracen-9-one;ethane;methanol?
10H-anthracen-9-one;ethane;methanol has a molecular weight of 256.34 g/mol, XLogP of 3.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-anthracen-9-one;ethane;methanol is sourced from PubChem (CID 90976205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).