About ethane;9H-fluorene;propanoic acid
ethane;9H-fluorene;propanoic acid (PubChem CID 90836645) has the molecular formula C24H40O2
and a molecular weight of 360.58 g/mol. Its IUPAC name is ethane;9H-fluorene;propanoic acid.
Molecular Properties
| Compound Name | ethane;9H-fluorene;propanoic acid |
| PubChem CID | 90836645 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | ethane;9H-fluorene;propanoic acid |
| SMILES | CC.CC.CC.CC.CCC(=O)O.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C3H6O2.4C2H6/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-3(4)5;4*1-2/h1-8H,9H2;2H2,1H3,(H,4,5);4*1-2H3 |
| InChIKey | ZVFHIDOAPCQBFK-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;9H-fluorene;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9H-fluorene;propanoic acid?
The IUPAC name of ethane;9H-fluorene;propanoic acid (CID 90836645) is ethane;9H-fluorene;propanoic acid.
What is the SMILES notation for ethane;9H-fluorene;propanoic acid?
The canonical SMILES for ethane;9H-fluorene;propanoic acid is CC.CC.CC.CC.CCC(=O)O.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of ethane;9H-fluorene;propanoic acid?
The InChIKey is ZVFHIDOAPCQBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C3H6O2.4C2H6/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-3(4)5;4*1-2/h1-8H,9H2;2H2,1H3,(H,4,5);4*1-2H3.
What are the key properties of ethane;9H-fluorene;propanoic acid?
ethane;9H-fluorene;propanoic acid has a molecular weight of 360.58 g/mol, XLogP of 7.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9H-fluorene;propanoic acid is sourced from PubChem (CID 90836645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).