C31H30O4 — CID 174827621
1,2-diphenyl-9H-fluorene;propanoic acid (PubChem CID 174827621) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1,2-diphenyl-9H-fluorene;propanoic acid.
| Compound Name | 1,2-diphenyl-9H-fluorene;propanoic acid |
|---|---|
| PubChem CID | 174827621 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 1,2-diphenyl-9H-fluorene;propanoic acid |
| SMILES | CCC(=O)O.CCC(=O)O.c1ccc(-c2ccc3c(c2-c2ccccc2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C25H18.2C3H6O2/c1-3-9-18(10-4-1)22-15-16-23-21-14-8-7-13-20(21)17-24(23)25(22)19-11-5-2-6-12-19;2*1-2-3(4)5/h1-16H,17H2;2*2H2,1H3,(H,4,5) |
| InChIKey | MRNGEQVXEJGBAP-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |