1,2-diphenyl-9H-fluorene;propanoic acid

C31H30O4 — CID 174827621

IUPAC1,2-diphenyl-9H-fluorene;propanoic acid
SMILESCCC(=O)O.CCC(=O)O.c1ccc(-c2ccc3c(c2-c2ccccc2)Cc2ccccc2-3)cc1
InChIInChI=1S/C25H18.2C3H6O2/c1-3-9-18(10-4-1)22-15-16-23-21-14-8-7-13-20(21)17-24(23)25(22)19-11-5-2-6-12-19;2*1-2-3(4)5/h1-16H,17H2;2*2H2,1H3,(H,4,5)
InChIKeyMRNGEQVXEJGBAP-UHFFFAOYSA-N
MW466.58 g/mol
LogP7.55
Rot. Bonds4

About 1,2-diphenyl-9H-fluorene;propanoic acid

1,2-diphenyl-9H-fluorene;propanoic acid (PubChem CID 174827621) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1,2-diphenyl-9H-fluorene;propanoic acid.

Molecular Properties

Compound Name1,2-diphenyl-9H-fluorene;propanoic acid
PubChem CID174827621
Molecular FormulaC31H30O4
Molecular Weight466.58 g/mol
Exact Mass466.21
IUPAC Name1,2-diphenyl-9H-fluorene;propanoic acid
SMILESCCC(=O)O.CCC(=O)O.c1ccc(-c2ccc3c(c2-c2ccccc2)Cc2ccccc2-3)cc1
InChIInChI=1S/C25H18.2C3H6O2/c1-3-9-18(10-4-1)22-15-16-23-21-14-8-7-13-20(21)17-24(23)25(22)19-11-5-2-6-12-19;2*1-2-3(4)5/h1-16H,17H2;2*2H2,1H3,(H,4,5)
InChIKeyMRNGEQVXEJGBAP-UHFFFAOYSA-N
XLogP7.55
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms35
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500466.58
LogP ≤ 57.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1,2-diphenyl-9H-fluorene;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-diphenyl-9H-fluorene;propanoic acid?
The IUPAC name of 1,2-diphenyl-9H-fluorene;propanoic acid (CID 174827621) is 1,2-diphenyl-9H-fluorene;propanoic acid.
What is the SMILES notation for 1,2-diphenyl-9H-fluorene;propanoic acid?
The canonical SMILES for 1,2-diphenyl-9H-fluorene;propanoic acid is CCC(=O)O.CCC(=O)O.c1ccc(-c2ccc3c(c2-c2ccccc2)Cc2ccccc2-3)cc1.
What is the InChIKey of 1,2-diphenyl-9H-fluorene;propanoic acid?
The InChIKey is MRNGEQVXEJGBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18.2C3H6O2/c1-3-9-18(10-4-1)22-15-16-23-21-14-8-7-13-20(21)17-24(23)25(22)19-11-5-2-6-12-19;2*1-2-3(4)5/h1-16H,17H2;2*2H2,1H3,(H,4,5).
What are the key properties of 1,2-diphenyl-9H-fluorene;propanoic acid?
1,2-diphenyl-9H-fluorene;propanoic acid has a molecular weight of 466.58 g/mol, XLogP of 7.55, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenyl-9H-fluorene;propanoic acid is sourced from PubChem (CID 174827621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).