About 9H-fluorene;propanoic acid
9H-fluorene;propanoic acid (PubChem CID 67831567) has the molecular formula C19H22O4
and a molecular weight of 314.38 g/mol. Its IUPAC name is 9H-fluorene;propanoic acid.
Molecular Properties
| Compound Name | 9H-fluorene;propanoic acid |
| PubChem CID | 67831567 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 9H-fluorene;propanoic acid |
| SMILES | CCC(=O)O.CCC(=O)O.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.2C3H6O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2*1-2-3(4)5/h1-8H,9H2;2*2H2,1H3,(H,4,5) |
| InChIKey | PRGKTGIZIJYQNJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluorene;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;propanoic acid?
The IUPAC name of 9H-fluorene;propanoic acid (CID 67831567) is 9H-fluorene;propanoic acid.
What is the SMILES notation for 9H-fluorene;propanoic acid?
The canonical SMILES for 9H-fluorene;propanoic acid is CCC(=O)O.CCC(=O)O.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;propanoic acid?
The InChIKey is PRGKTGIZIJYQNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.2C3H6O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2*1-2-3(4)5/h1-8H,9H2;2*2H2,1H3,(H,4,5).
What are the key properties of 9H-fluorene;propanoic acid?
9H-fluorene;propanoic acid has a molecular weight of 314.38 g/mol, XLogP of 4.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;propanoic acid is sourced from PubChem (CID 67831567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).