About ethanamine;9H-fluorene
ethanamine;9H-fluorene (PubChem CID 158316259) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is ethanamine;9H-fluorene.
Molecular Properties
| Compound Name | ethanamine;9H-fluorene |
| PubChem CID | 158316259 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | ethanamine;9H-fluorene |
| SMILES | CCN.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C2H7N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-3/h1-8H,9H2;2-3H2,1H3 |
| InChIKey | GOHJKKUMLRIEML-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethanamine;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;9H-fluorene?
The IUPAC name of ethanamine;9H-fluorene (CID 158316259) is ethanamine;9H-fluorene.
What is the SMILES notation for ethanamine;9H-fluorene?
The canonical SMILES for ethanamine;9H-fluorene is CCN.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of ethanamine;9H-fluorene?
The InChIKey is GOHJKKUMLRIEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C2H7N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-3/h1-8H,9H2;2-3H2,1H3.
What are the key properties of ethanamine;9H-fluorene?
ethanamine;9H-fluorene has a molecular weight of 211.31 g/mol, XLogP of 3.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;9H-fluorene is sourced from PubChem (CID 158316259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).