About pentakis(N-ethylethanamine);9H-fluorene
pentakis(N-ethylethanamine);9H-fluorene (PubChem CID 172860190) has the molecular formula C33H65N5
and a molecular weight of 531.92 g/mol. Its IUPAC name is pentakis(N-ethylethanamine);9H-fluorene.
Molecular Properties
| Compound Name | pentakis(N-ethylethanamine);9H-fluorene |
| PubChem CID | 172860190 |
| Molecular Formula | C33H65N5 |
| Molecular Weight | 531.92 g/mol |
| Exact Mass | 531.52 |
| IUPAC Name | pentakis(N-ethylethanamine);9H-fluorene |
| SMILES | CCNCC.CCNCC.CCNCC.CCNCC.CCNCC.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.5C4H11N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;5*1-3-5-4-2/h1-8H,9H2;5*5H,3-4H2,1-2H3 |
| InChIKey | ZGAHOLJSUXUNRR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.92 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pentakis(N-ethylethanamine);9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentakis(N-ethylethanamine);9H-fluorene?
The IUPAC name of pentakis(N-ethylethanamine);9H-fluorene (CID 172860190) is pentakis(N-ethylethanamine);9H-fluorene.
What is the SMILES notation for pentakis(N-ethylethanamine);9H-fluorene?
The canonical SMILES for pentakis(N-ethylethanamine);9H-fluorene is CCNCC.CCNCC.CCNCC.CCNCC.CCNCC.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of pentakis(N-ethylethanamine);9H-fluorene?
The InChIKey is ZGAHOLJSUXUNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.5C4H11N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;5*1-3-5-4-2/h1-8H,9H2;5*5H,3-4H2,1-2H3.
What are the key properties of pentakis(N-ethylethanamine);9H-fluorene?
pentakis(N-ethylethanamine);9H-fluorene has a molecular weight of 531.92 g/mol, XLogP of 6.34, 10 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentakis(N-ethylethanamine);9H-fluorene is sourced from PubChem (CID 172860190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).