C11H17N — CID 175235402
bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine (PubChem CID 175235402) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine |
|---|---|
| PubChem CID | 175235402 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine |
| SMILES | CCNCC.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.C4H11N/c1-2-4-7-5-6(7)3-1;1-3-5-4-2/h1-4H,5H2;5H,3-4H2,1-2H3 |
| InChIKey | POALTOAIOUKSAM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |