About bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine
bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine (PubChem CID 175235402) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine |
| PubChem CID | 175235402 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine |
| SMILES | CCNCC.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.C4H11N/c1-2-4-7-5-6(7)3-1;1-3-5-4-2/h1-4H,5H2;5H,3-4H2,1-2H3 |
| InChIKey | POALTOAIOUKSAM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine (CID 175235402) is bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine is CCNCC.c1ccc2c(c1)C2.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine?
The InChIKey is POALTOAIOUKSAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6.C4H11N/c1-2-4-7-5-6(7)3-1;1-3-5-4-2/h1-4H,5H2;5H,3-4H2,1-2H3.
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine?
bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine has a molecular weight of 163.26 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-triene;N-ethylethanamine is sourced from PubChem (CID 175235402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).