About 9,10-dihydroanthracene;methanamine
9,10-dihydroanthracene;methanamine (PubChem CID 123513741) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 9,10-dihydroanthracene;methanamine.
Molecular Properties
| Compound Name | 9,10-dihydroanthracene;methanamine |
| PubChem CID | 123513741 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 9,10-dihydroanthracene;methanamine |
| SMILES | CN.CN.c1ccc2c(c1)Cc1ccccc1C2 |
| InChI | InChI=1S/C14H12.2CH5N/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;2*1-2/h1-8H,9-10H2;2*2H2,1H3 |
| InChIKey | ASGSTMFWDNWARH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9,10-dihydroanthracene;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dihydroanthracene;methanamine?
The IUPAC name of 9,10-dihydroanthracene;methanamine (CID 123513741) is 9,10-dihydroanthracene;methanamine.
What is the SMILES notation for 9,10-dihydroanthracene;methanamine?
The canonical SMILES for 9,10-dihydroanthracene;methanamine is CN.CN.c1ccc2c(c1)Cc1ccccc1C2.
What is the InChIKey of 9,10-dihydroanthracene;methanamine?
The InChIKey is ASGSTMFWDNWARH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.2CH5N/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;2*1-2/h1-8H,9-10H2;2*2H2,1H3.
What are the key properties of 9,10-dihydroanthracene;methanamine?
9,10-dihydroanthracene;methanamine has a molecular weight of 242.37 g/mol, XLogP of 2.33, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dihydroanthracene;methanamine is sourced from PubChem (CID 123513741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).