C16H22N2 — CID 123513741
9,10-dihydroanthracene;methanamine (PubChem CID 123513741) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 9,10-dihydroanthracene;methanamine.
| Compound Name | 9,10-dihydroanthracene;methanamine |
|---|---|
| PubChem CID | 123513741 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 9,10-dihydroanthracene;methanamine |
| SMILES | CN.CN.c1ccc2c(c1)Cc1ccccc1C2 |
| InChI | InChI=1S/C14H12.2CH5N/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;2*1-2/h1-8H,9-10H2;2*2H2,1H3 |
| InChIKey | ASGSTMFWDNWARH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |