C8H10 — CID 157397080
bicyclo[4.1.0]hepta-1,3,5-triene;methane (PubChem CID 157397080) has the molecular formula C8H10 and a molecular weight of 106.17 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;methane.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;methane |
|---|---|
| PubChem CID | 157397080 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;methane |
| SMILES | C.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.CH4/c1-2-4-7-5-6(7)3-1;/h1-4H,5H2;1H4 |
| InChIKey | BMRSDFIAJWTGEN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |