C11H10 — CID 91124939
bicyclo[8.1.0]undeca-1,3,5,7,9-pentaene (PubChem CID 91124939) has the molecular formula C11H10 and a molecular weight of 142.20 g/mol. Its IUPAC name is bicyclo[8.1.0]undeca-1,3,5,7,9-pentaene.
| Compound Name | bicyclo[8.1.0]undeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 91124939 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | bicyclo[8.1.0]undeca-1,3,5,7,9-pentaene |
| SMILES | c1ccccc2c(ccc1)C2 |
| InChI | InChI=1S/C11H10/c1-2-4-6-8-11-9-10(11)7-5-3-1/h1-8H,9H2/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,8-6+,10-7-,11-8- |
| InChIKey | FBRZLQFOMLXMBV-HORLBPKYSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |