About azulene
azulene (PubChem CID 9231) has the molecular formula C10H8
and a molecular weight of 128.17 g/mol. Its IUPAC name is azulene.
Molecular Properties
| Compound Name | azulene |
| PubChem CID | 9231 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | azulene |
| SMILES | c1ccc2cccc-2cc1 |
| InChI | InChI=1S/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
| InChIKey | CUFNKYGDVFVPHO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze azulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulene?
The IUPAC name of azulene (CID 9231) is azulene.
What is the SMILES notation for azulene?
The canonical SMILES for azulene is c1ccc2cccc-2cc1.
What is the InChIKey of azulene?
The InChIKey is CUFNKYGDVFVPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H.
What are the key properties of azulene?
azulene has a molecular weight of 128.17 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azulene is sourced from PubChem (CID 9231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).