About 1,4-dimethylazulene
1,4-dimethylazulene (PubChem CID 6429347) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is 1,4-dimethylazulene.
Molecular Properties
| Compound Name | 1,4-dimethylazulene |
| PubChem CID | 6429347 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1,4-dimethylazulene |
| SMILES | Cc1ccc2c(C)ccccc1-2 |
| InChI | InChI=1S/C12H12/c1-9-5-3-4-6-11-10(2)7-8-12(9)11/h3-8H,1-2H3 |
| InChIKey | FKBGSRCZHMNHGG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-dimethylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylazulene?
The IUPAC name of 1,4-dimethylazulene (CID 6429347) is 1,4-dimethylazulene.
What is the SMILES notation for 1,4-dimethylazulene?
The canonical SMILES for 1,4-dimethylazulene is Cc1ccc2c(C)ccccc1-2.
What is the InChIKey of 1,4-dimethylazulene?
The InChIKey is FKBGSRCZHMNHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12/c1-9-5-3-4-6-11-10(2)7-8-12(9)11/h3-8H,1-2H3.
What are the key properties of 1,4-dimethylazulene?
1,4-dimethylazulene has a molecular weight of 156.23 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylazulene is sourced from PubChem (CID 6429347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).