C14H14 — CID 173262949
bicyclo[4.1.0]hepta-1,3,5-triene;toluene (PubChem CID 173262949) has the molecular formula C14H14 and a molecular weight of 182.27 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;toluene.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;toluene |
|---|---|
| PubChem CID | 173262949 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;toluene |
| SMILES | Cc1ccccc1.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.C7H8/c1-2-4-7-5-6(7)3-1;1-7-5-3-2-4-6-7/h1-4H,5H2;2-6H,1H3 |
| InChIKey | RWFFAWSJYDQLRF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |