About bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium
bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium (PubChem CID 18403077) has the molecular formula C8H10O2P+
and a molecular weight of 169.14 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium |
| PubChem CID | 18403077 |
| Molecular Formula | C8H10O2P+ |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium |
| SMILES | C[P+](=O)O.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.CH3O2P/c1-2-4-7-5-6(7)3-1;1-4(2)3/h1-4H,5H2;1H3/p+1 |
| InChIKey | IPFYUCJKUPNQIZ-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium (CID 18403077) is bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium is C[P+](=O)O.c1ccc2c(c1)C2.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium?
The InChIKey is IPFYUCJKUPNQIZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H6.CH3O2P/c1-2-4-7-5-6(7)3-1;1-4(2)3/h1-4H,5H2;1H3/p+1.
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium?
bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium has a molecular weight of 169.14 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium is sourced from PubChem (CID 18403077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).