C8H10O2P+ — CID 18403077
bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium (PubChem CID 18403077) has the molecular formula C8H10O2P+ and a molecular weight of 169.14 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 18403077 |
| Molecular Formula | C8H10O2P+ |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;hydroxy-methyl-oxophosphanium |
| SMILES | C[P+](=O)O.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.CH3O2P/c1-2-4-7-5-6(7)3-1;1-4(2)3/h1-4H,5H2;1H3/p+1 |
| InChIKey | IPFYUCJKUPNQIZ-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|