C8H10N2O2 — CID 19082332
bicyclo[4.1.0]hepta-1,3,5-triene;hydroxyurea (PubChem CID 19082332) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;hydroxyurea.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;hydroxyurea |
|---|---|
| PubChem CID | 19082332 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;hydroxyurea |
| SMILES | NC(=O)NO.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.CH4N2O2/c1-2-4-7-5-6(7)3-1;2-1(4)3-5/h1-4H,5H2;5H,(H3,2,3,4) |
| InChIKey | URTWQHWKRVCIHB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|