About acetic acid;azane;9H-fluorene
acetic acid;azane;9H-fluorene (PubChem CID 174966259) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is acetic acid;azane;9H-fluorene.
Molecular Properties
| Compound Name | acetic acid;azane;9H-fluorene |
| PubChem CID | 174966259 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | acetic acid;azane;9H-fluorene |
| SMILES | CC(=O)O.N.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C2H4O2.H3N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2(3)4;/h1-8H,9H2;1H3,(H,3,4);1H3 |
| InChIKey | PNYZWCPAZLCPMH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;azane;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;azane;9H-fluorene?
The IUPAC name of acetic acid;azane;9H-fluorene (CID 174966259) is acetic acid;azane;9H-fluorene.
What is the SMILES notation for acetic acid;azane;9H-fluorene?
The canonical SMILES for acetic acid;azane;9H-fluorene is CC(=O)O.N.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of acetic acid;azane;9H-fluorene?
The InChIKey is PNYZWCPAZLCPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C2H4O2.H3N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2(3)4;/h1-8H,9H2;1H3,(H,3,4);1H3.
What are the key properties of acetic acid;azane;9H-fluorene?
acetic acid;azane;9H-fluorene has a molecular weight of 243.31 g/mol, XLogP of 3.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;azane;9H-fluorene is sourced from PubChem (CID 174966259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).