About 9H-fluorene;methyl acetate
9H-fluorene;methyl acetate (PubChem CID 143080534) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 9H-fluorene;methyl acetate.
Molecular Properties
| Compound Name | 9H-fluorene;methyl acetate |
| PubChem CID | 143080534 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 9H-fluorene;methyl acetate |
| SMILES | COC(C)=O.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C3H6O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3(4)5-2/h1-8H,9H2;1-2H3 |
| InChIKey | FSKUPULOIZSROI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluorene;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;methyl acetate?
The IUPAC name of 9H-fluorene;methyl acetate (CID 143080534) is 9H-fluorene;methyl acetate.
What is the SMILES notation for 9H-fluorene;methyl acetate?
The canonical SMILES for 9H-fluorene;methyl acetate is COC(C)=O.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;methyl acetate?
The InChIKey is FSKUPULOIZSROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C3H6O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3(4)5-2/h1-8H,9H2;1-2H3.
What are the key properties of 9H-fluorene;methyl acetate?
9H-fluorene;methyl acetate has a molecular weight of 240.30 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;methyl acetate is sourced from PubChem (CID 143080534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).