C12H16 — CID 90790754
ethane;2-methylidene-1,3-dihydroindene (PubChem CID 90790754) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is ethane;2-methylidene-1,3-dihydroindene.
| Compound Name | ethane;2-methylidene-1,3-dihydroindene |
|---|---|
| PubChem CID | 90790754 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | ethane;2-methylidene-1,3-dihydroindene |
| SMILES | C=C1Cc2ccccc2C1.CC |
| InChI | InChI=1S/C10H10.C2H6/c1-8-6-9-4-2-3-5-10(9)7-8;1-2/h2-5H,1,6-7H2;1-2H3 |
| InChIKey | GLZDNIOCBLLACC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|