C18H18 — CID 163412010
2-(2,4,6-trimethylidenecyclohexylidene)-1,3-dihydroindene (PubChem CID 163412010) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-(2,4,6-trimethylidenecyclohexylidene)-1,3-dihydroindene.
| Compound Name | 2-(2,4,6-trimethylidenecyclohexylidene)-1,3-dihydroindene |
|---|---|
| PubChem CID | 163412010 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-(2,4,6-trimethylidenecyclohexylidene)-1,3-dihydroindene |
| SMILES | C=C1CC(=C)C(=C2Cc3ccccc3C2)C(=C)C1 |
| InChI | InChI=1S/C18H18/c1-12-8-13(2)18(14(3)9-12)17-10-15-6-4-5-7-16(15)11-17/h4-7H,1-3,8-11H2 |
| InChIKey | ZDGYDCZXBMWGMY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|