C14H16 — CID 12777064
1,2,3,4,9,10-hexahydroanthracene (PubChem CID 12777064) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1,2,3,4,9,10-hexahydroanthracene.
| Compound Name | 1,2,3,4,9,10-hexahydroanthracene |
|---|---|
| PubChem CID | 12777064 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1,2,3,4,9,10-hexahydroanthracene |
| SMILES | c1ccc2c(c1)CC1=C(CCCC1)C2 |
| InChI | InChI=1S/C14H16/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | HDGCDASGELNYIR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|