C16H14 — CID 20739785
2-ethenyl-9,10-dihydroanthracene (PubChem CID 20739785) has the molecular formula C16H14 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-ethenyl-9,10-dihydroanthracene.
| Compound Name | 2-ethenyl-9,10-dihydroanthracene |
|---|---|
| PubChem CID | 20739785 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-ethenyl-9,10-dihydroanthracene |
| SMILES | C=Cc1ccc2c(c1)Cc1ccccc1C2 |
| InChI | InChI=1S/C16H14/c1-2-12-7-8-15-10-13-5-3-4-6-14(13)11-16(15)9-12/h2-9H,1,10-11H2 |
| InChIKey | FYOJLKPRZKYEKR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |