C10H11B — CID 170597533
6-ethenyl-2,3-dihydro-1H-1-benzoborole (PubChem CID 170597533) has the molecular formula C10H11B and a molecular weight of 142.01 g/mol. Its IUPAC name is 6-ethenyl-2,3-dihydro-1H-1-benzoborole.
| Compound Name | 6-ethenyl-2,3-dihydro-1H-1-benzoborole |
|---|---|
| PubChem CID | 170597533 |
| Molecular Formula | C10H11B |
| Molecular Weight | 142.01 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 6-ethenyl-2,3-dihydro-1H-1-benzoborole |
| SMILES | C=Cc1ccc2c(c1)BCC2 |
| InChI | InChI=1S/C10H11B/c1-2-8-3-4-9-5-6-11-10(9)7-8/h2-4,7,11H,1,5-6H2 |
| InChIKey | VHSTVANOEBZRDK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.01 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|