C20H28 — CID 23508601
1,2-dicyclohexyl-4-ethenylbenzene (PubChem CID 23508601) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1,2-dicyclohexyl-4-ethenylbenzene.
| Compound Name | 1,2-dicyclohexyl-4-ethenylbenzene |
|---|---|
| PubChem CID | 23508601 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1,2-dicyclohexyl-4-ethenylbenzene |
| SMILES | C=Cc1ccc(C2CCCCC2)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C20H28/c1-2-16-13-14-19(17-9-5-3-6-10-17)20(15-16)18-11-7-4-8-12-18/h2,13-15,17-18H,1,3-12H2 |
| InChIKey | YAVPIJATNCPJLY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |