C12H13NO — CID 130040392
4-amino-7-ethenyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 130040392) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 4-amino-7-ethenyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 4-amino-7-ethenyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 130040392 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4-amino-7-ethenyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | C=Cc1ccc2c(c1)C(=O)CCC2N |
| InChI | InChI=1S/C12H13NO/c1-2-8-3-4-9-10(7-8)12(14)6-5-11(9)13/h2-4,7,11H,1,5-6,13H2 |
| InChIKey | WXBQNBIEJWJBLS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |