C12H15N — CID 130914652
(1S)-6-ethenyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 130914652) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (1S)-6-ethenyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S)-6-ethenyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 130914652 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (1S)-6-ethenyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C=Cc1ccc2c(c1)CCC[C@@H]2N |
| InChI | InChI=1S/C12H15N/c1-2-9-6-7-11-10(8-9)4-3-5-12(11)13/h2,6-8,12H,1,3-5,13H2/t12-/m0/s1 |
| InChIKey | NTKBYZLHIXXENM-LBPRGKRZSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |