C11H16N2 — CID 83816639
6-N-methyl-1,2,3,4-tetrahydronaphthalene-1,6-diamine (PubChem CID 83816639) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-N-methyl-1,2,3,4-tetrahydronaphthalene-1,6-diamine.
| Compound Name | 6-N-methyl-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
|---|---|
| PubChem CID | 83816639 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 6-N-methyl-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
| SMILES | CNc1ccc2c(c1)CCCC2N |
| InChI | InChI=1S/C11H16N2/c1-13-9-5-6-10-8(7-9)3-2-4-11(10)12/h5-7,11,13H,2-4,12H2,1H3 |
| InChIKey | WLRZQMDCTZOICM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |