(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid

C11H14N2O2 — CID 135386697

IUPAC(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid
SMILESNC1CCCc2cc(NC(=O)O)ccc21
InChIInChI=1S/C11H14N2O2/c12-10-3-1-2-7-6-8(13-11(14)15)4-5-9(7)10/h4-6,10,13H,1-3,12H2,(H,14,15)
InChIKeyLRURKDCXGBLWRA-UHFFFAOYSA-N
MW206.25 g/mol
LogP2.11
Rot. Bonds1

About (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid

(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid (PubChem CID 135386697) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid.

Molecular Properties

Compound Name(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid
PubChem CID135386697
Molecular FormulaC11H14N2O2
Molecular Weight206.25 g/mol
Exact Mass206.11
IUPAC Name(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid
SMILESNC1CCCc2cc(NC(=O)O)ccc21
InChIInChI=1S/C11H14N2O2/c12-10-3-1-2-7-6-8(13-11(14)15)4-5-9(7)10/h4-6,10,13H,1-3,12H2,(H,14,15)
InChIKeyLRURKDCXGBLWRA-UHFFFAOYSA-N
XLogP2.11
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.25
LogP ≤ 52.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid?
The IUPAC name of (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid (CID 135386697) is (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid.
What is the SMILES notation for (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid?
The canonical SMILES for (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid is NC1CCCc2cc(NC(=O)O)ccc21.
What is the InChIKey of (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid?
The InChIKey is LRURKDCXGBLWRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c12-10-3-1-2-7-6-8(13-11(14)15)4-5-9(7)10/h4-6,10,13H,1-3,12H2,(H,14,15).
What are the key properties of (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid?
(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid has a molecular weight of 206.25 g/mol, XLogP of 2.11, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)carbamic acid is sourced from PubChem (CID 135386697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).