C15H20N2O2 — CID 102372506
(1R,8S)-1,8-diamino-3,4,5,6,7,8-hexahydro-2H-anthracene-1-carboxylic acid (PubChem CID 102372506) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (1R,8S)-1,8-diamino-3,4,5,6,7,8-hexahydro-2H-anthracene-1-carboxylic acid.
| Compound Name | (1R,8S)-1,8-diamino-3,4,5,6,7,8-hexahydro-2H-anthracene-1-carboxylic acid |
|---|---|
| PubChem CID | 102372506 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (1R,8S)-1,8-diamino-3,4,5,6,7,8-hexahydro-2H-anthracene-1-carboxylic acid |
| SMILES | N[C@H]1CCCc2cc3c(cc21)[C@@](N)(C(=O)O)CCC3 |
| InChI | InChI=1S/C15H20N2O2/c16-13-5-1-3-9-7-10-4-2-6-15(17,14(18)19)12(10)8-11(9)13/h7-8,13H,1-6,16-17H2,(H,18,19)/t13-,15+/m0/s1 |
| InChIKey | SNTJKEIPFSLGOM-DZGCQCFKSA-N |
| XLogP | 1.60 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |