C10H12FNO — CID 131140736
(5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 131140736) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is (5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 131140736 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | N[C@H]1CCCc2cc(O)c(F)cc21 |
| InChI | InChI=1S/C10H12FNO/c11-8-5-7-6(4-10(8)13)2-1-3-9(7)12/h4-5,9,13H,1-3,12H2/t9-/m0/s1 |
| InChIKey | LRSHQSMAPVHYLF-VIFPVBQESA-N |
| XLogP | 1.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |