C10H12FNO — CID 20755569
(6R)-6-amino-3-fluoro-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 20755569) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is (6R)-6-amino-3-fluoro-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6R)-6-amino-3-fluoro-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 20755569 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (6R)-6-amino-3-fluoro-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | N[C@@H]1CCc2cc(O)c(F)cc2C1 |
| InChI | InChI=1S/C10H12FNO/c11-9-4-7-3-8(12)2-1-6(7)5-10(9)13/h4-5,8,13H,1-3,12H2/t8-/m1/s1 |
| InChIKey | VGMILXFBLSGTPW-MRVPVSSYSA-N |
| XLogP | 1.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |