C9H12N2O — CID 55294365
3,6-diamino-2,3-dihydro-1H-inden-5-ol (PubChem CID 55294365) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 3,6-diamino-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 3,6-diamino-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 55294365 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3,6-diamino-2,3-dihydro-1H-inden-5-ol |
| SMILES | Nc1cc2c(cc1O)C(N)CC2 |
| InChI | InChI=1S/C9H12N2O/c10-7-2-1-5-3-8(11)9(12)4-6(5)7/h3-4,7,12H,1-2,10-11H2 |
| InChIKey | ULVGMIUDIFIWSF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|