C9H9BrIN — CID 130625504
(1R)-6-bromo-5-iodo-2,3-dihydro-1H-inden-1-amine (PubChem CID 130625504) has the molecular formula C9H9BrIN and a molecular weight of 337.99 g/mol. Its IUPAC name is (1R)-6-bromo-5-iodo-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1R)-6-bromo-5-iodo-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 130625504 |
| Molecular Formula | C9H9BrIN |
| Molecular Weight | 337.99 g/mol |
| Exact Mass | 336.90 |
| IUPAC Name | (1R)-6-bromo-5-iodo-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@@H]1CCc2cc(I)c(Br)cc21 |
| InChI | InChI=1S/C9H9BrIN/c10-7-4-6-5(3-8(7)11)1-2-9(6)12/h3-4,9H,1-2,12H2/t9-/m1/s1 |
| InChIKey | SJZDMZVNFHRLLU-SECBINFHSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|