C10H13NO2 — CID 130688462
(1R)-1-amino-6-methoxy-2,3-dihydro-1H-inden-5-ol (PubChem CID 130688462) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (1R)-1-amino-6-methoxy-2,3-dihydro-1H-inden-5-ol.
| Compound Name | (1R)-1-amino-6-methoxy-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 130688462 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (1R)-1-amino-6-methoxy-2,3-dihydro-1H-inden-5-ol |
| SMILES | COc1cc2c(cc1O)CC[C@H]2N |
| InChI | InChI=1S/C10H13NO2/c1-13-10-5-7-6(4-9(10)12)2-3-8(7)11/h4-5,8,12H,2-3,11H2,1H3/t8-/m1/s1 |
| InChIKey | HJIRTSWOTNGHHA-MRVPVSSYSA-N |
| XLogP | 1.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |