C19H26O3 — CID 163624357
(14R,15S)-8-methoxytetracyclo[12.3.1.02,11.05,10]octadeca-5,7,9-triene-7,15-diol (PubChem CID 163624357) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (14R,15S)-8-methoxytetracyclo[12.3.1.02,11.05,10]octadeca-5,7,9-triene-7,15-diol.
| Compound Name | (14R,15S)-8-methoxytetracyclo[12.3.1.02,11.05,10]octadeca-5,7,9-triene-7,15-diol |
|---|---|
| PubChem CID | 163624357 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (14R,15S)-8-methoxytetracyclo[12.3.1.02,11.05,10]octadeca-5,7,9-triene-7,15-diol |
| SMILES | COc1cc2c(cc1O)CCC1C3CC[C@H](O)[C@H](CCC21)C3 |
| InChI | InChI=1S/C19H26O3/c1-22-19-10-16-12(9-18(19)21)2-5-14-11-4-7-17(20)13(8-11)3-6-15(14)16/h9-11,13-15,17,20-21H,2-8H2,1H3/t11?,13-,14?,15?,17+/m1/s1 |
| InChIKey | HQVMNINLFLDJFN-MQMQYENRSA-N |
| XLogP | 3.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |