C21H28O4 — CID 58791089
(13'S)-2'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol (PubChem CID 58791089) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (13'S)-2'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol.
| Compound Name | (13'S)-2'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol |
|---|---|
| PubChem CID | 58791089 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (13'S)-2'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol |
| SMILES | COc1cc2c(cc1O)CCC1C2CC[C@@]2(C)C1CCC21OCCO1 |
| InChI | InChI=1S/C21H28O4/c1-20-7-5-14-15(17(20)6-8-21(20)24-9-10-25-21)4-3-13-11-18(22)19(23-2)12-16(13)14/h11-12,14-15,17,22H,3-10H2,1-2H3/t14?,15?,17?,20-/m0/s1 |
| InChIKey | NSGOLKGQPZWMKY-ZXGDDTLZSA-N |
| XLogP | 4.00 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |