C24H34O4S — CID 59676572
(13'S)-2'-ethylsulfanyl-3'-(methoxymethoxy)-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] (PubChem CID 59676572) has the molecular formula C24H34O4S and a molecular weight of 418.60 g/mol. Its IUPAC name is (13'S)-2'-ethylsulfanyl-3'-(methoxymethoxy)-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene].
| Compound Name | (13'S)-2'-ethylsulfanyl-3'-(methoxymethoxy)-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 59676572 |
| Molecular Formula | C24H34O4S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (13'S)-2'-ethylsulfanyl-3'-(methoxymethoxy)-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] |
| SMILES | CCSc1cc2c(cc1OCOC)CCC1C2CC[C@@]2(C)C1CCC21OCCO1 |
| InChI | InChI=1S/C24H34O4S/c1-4-29-22-14-19-16(13-21(22)26-15-25-3)5-6-18-17(19)7-9-23(2)20(18)8-10-24(23)27-11-12-28-24/h13-14,17-18,20H,4-12,15H2,1-3H3/t17?,18?,20?,23-/m0/s1 |
| InChIKey | QUNXOYQHMURGPX-PSSUFBQTSA-N |
| XLogP | 5.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|