C21H30O2S — CID 59676564
(13S)-3-(methoxymethoxy)-13-methyl-2-methylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 59676564) has the molecular formula C21H30O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is (13S)-3-(methoxymethoxy)-13-methyl-2-methylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (13S)-3-(methoxymethoxy)-13-methyl-2-methylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 59676564 |
| Molecular Formula | C21H30O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (13S)-3-(methoxymethoxy)-13-methyl-2-methylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | COCOc1cc2c(cc1SC)C1CC[C@]3(C)CCCC3C1CC2 |
| InChI | InChI=1S/C21H30O2S/c1-21-9-4-5-18(21)16-7-6-14-11-19(23-13-22-2)20(24-3)12-17(14)15(16)8-10-21/h11-12,15-16,18H,4-10,13H2,1-3H3/t15?,16?,18?,21-/m0/s1 |
| InChIKey | FDXFVLZGMWTDDP-MGGPMZQCSA-N |
| XLogP | 5.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|