C24H37BO6 — CID 10113630
[(13S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]-dimethoxyborane (PubChem CID 10113630) has the molecular formula C24H37BO6 and a molecular weight of 432.37 g/mol. Its IUPAC name is [(13S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]-dimethoxyborane.
| Compound Name | [(13S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]-dimethoxyborane |
|---|---|
| PubChem CID | 10113630 |
| Molecular Formula | C24H37BO6 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | [(13S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]-dimethoxyborane |
| SMILES | COCOc1cc2c(cc1B(OC)OC)C1CC[C@@]3(C)C(CC[C@@H]3OCOC)C1CC2 |
| InChI | InChI=1S/C24H37BO6/c1-24-11-10-17-18(20(24)8-9-23(24)31-15-27-3)7-6-16-12-22(30-14-26-2)21(13-19(16)17)25(28-4)29-5/h12-13,17-18,20,23H,6-11,14-15H2,1-5H3/t17?,18?,20?,23-,24-/m0/s1 |
| InChIKey | MCWTTYMQQMTUAE-MGROQWRWSA-N |
| XLogP | 3.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|