C24H36O4 — CID 171379467
(8R,9S,13S,14S,17S)-3,17-bis(ethoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 171379467) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-3,17-bis(ethoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,13S,14S,17S)-3,17-bis(ethoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 171379467 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (8R,9S,13S,14S,17S)-3,17-bis(ethoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CCOCOc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OCOCC)CC[C@@H]12 |
| InChI | InChI=1S/C24H36O4/c1-4-25-15-27-18-7-9-19-17(14-18)6-8-21-20(19)12-13-24(3)22(21)10-11-23(24)28-16-26-5-2/h7,9,14,20-23H,4-6,8,10-13,15-16H2,1-3H3/t20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | HNIBKCKVCQXDCU-DJCPXJLLSA-N |
| XLogP | 5.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|