C19H27O2P — CID 144809032
[(13S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxyphosphane (PubChem CID 144809032) has the molecular formula C19H27O2P and a molecular weight of 318.40 g/mol. Its IUPAC name is [(13S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxyphosphane.
| Compound Name | [(13S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxyphosphane |
|---|---|
| PubChem CID | 144809032 |
| Molecular Formula | C19H27O2P |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [(13S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxyphosphane |
| SMILES | COc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1CC[C@@H]2OP |
| InChI | InChI=1S/C19H27O2P/c1-19-10-9-15-14-6-4-13(20-2)11-12(14)3-5-16(15)17(19)7-8-18(19)21-22/h4,6,11,15-18H,3,5,7-10,22H2,1-2H3/t15?,16?,17?,18-,19-/m0/s1 |
| InChIKey | PXUXMPSUMAKAHT-QKBRSHRXSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|