C23H36O2 — CID 145003626
ethane;1-(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)ethanol (PubChem CID 145003626) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is ethane;1-(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)ethanol.
| Compound Name | ethane;1-(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)ethanol |
|---|---|
| PubChem CID | 145003626 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | ethane;1-(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)ethanol |
| SMILES | CC.COc1ccc2c(c1)CCC1C2CCC2(C)C(C(C)O)CCC12 |
| InChI | InChI=1S/C21H30O2.C2H6/c1-13(22)19-8-9-20-18-6-4-14-12-15(23-3)5-7-16(14)17(18)10-11-21(19,20)2;1-2/h5,7,12-13,17-20,22H,4,6,8-11H2,1-3H3;1-2H3 |
| InChIKey | YNQBLXKKQLVPBG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |