C28H46O2Si — CID 53379309
[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy-tri(propan-2-yl)silane (PubChem CID 53379309) has the molecular formula C28H46O2Si and a molecular weight of 442.76 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 53379309 |
| Molecular Formula | C28H46O2Si |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | [(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy-tri(propan-2-yl)silane |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(O[Si](C(C)C)(C(C)C)C(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C28H46O2Si/c1-18(2)31(19(3)4,20(5)6)30-27-14-13-26-25-11-9-21-17-22(29-8)10-12-23(21)24(25)15-16-28(26,27)7/h10,12,17-20,24-27H,9,11,13-16H2,1-8H3/t24-,25-,26+,27?,28+/m1/s1 |
| InChIKey | NTOPGSQVGGTDRG-XUHYMAQVSA-N |
| XLogP | 8.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|