C24H34O3 — CID 169440017
[(13S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate (PubChem CID 169440017) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is [(13S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate.
| Compound Name | [(13S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
|---|---|
| PubChem CID | 169440017 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [(13S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@H]1CCC2C3CCc4cc(OC)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C24H34O3/c1-4-5-6-23(25)27-22-12-11-21-20-9-7-16-15-17(26-3)8-10-18(16)19(20)13-14-24(21,22)2/h8,10,15,19-22H,4-7,9,11-14H2,1-3H3/t19?,20?,21?,22-,24-/m0/s1 |
| InChIKey | JUFSCZWQPRYRQG-BNDFGDQLSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |