C34H44N2O9 — CID 59801755
1-O-(4-amino-2-carbamoyl-3-hydroxyphenyl) 8-O-(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 4,5-dihydroxyoctanedioate (PubChem CID 59801755) has the molecular formula C34H44N2O9 and a molecular weight of 624.73 g/mol. Its IUPAC name is 1-O-(4-amino-2-carbamoyl-3-hydroxyphenyl) 8-O-(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 4,5-dihydroxyoctanedioate.
| Compound Name | 1-O-(4-amino-2-carbamoyl-3-hydroxyphenyl) 8-O-(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 4,5-dihydroxyoctanedioate |
|---|---|
| PubChem CID | 59801755 |
| Molecular Formula | C34H44N2O9 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | 1-O-(4-amino-2-carbamoyl-3-hydroxyphenyl) 8-O-(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 4,5-dihydroxyoctanedioate |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(OC(=O)CCC(O)C(O)CCC(=O)Oc3ccc(N)c(O)c3C(N)=O)CCC12 |
| InChI | InChI=1S/C34H44N2O9/c1-34-16-15-21-20-6-4-19(43-2)17-18(20)3-5-22(21)23(34)7-12-28(34)45-30(40)14-10-26(38)25(37)9-13-29(39)44-27-11-8-24(35)32(41)31(27)33(36)42/h4,6,8,11,17,21-23,25-26,28,37-38,41H,3,5,7,9-10,12-16,35H2,1-2H3,(H2,36,42) |
| InChIKey | QCMSIWNWNCVGHA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 191.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|