C37H53N2O9P — CID 59801774
ditert-butyl [(13R,17R)-17-[3-(3-carbamoyl-2-hydroxy-4-methoxyanilino)-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] phosphate (PubChem CID 59801774) has the molecular formula C37H53N2O9P and a molecular weight of 700.81 g/mol. Its IUPAC name is ditert-butyl [(13R,17R)-17-[3-(3-carbamoyl-2-hydroxy-4-methoxyanilino)-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] phosphate.
| Compound Name | ditert-butyl [(13R,17R)-17-[3-(3-carbamoyl-2-hydroxy-4-methoxyanilino)-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] phosphate |
|---|---|
| PubChem CID | 59801774 |
| Molecular Formula | C37H53N2O9P |
| Molecular Weight | 700.81 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | ditert-butyl [(13R,17R)-17-[3-(3-carbamoyl-2-hydroxy-4-methoxyanilino)-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] phosphate |
| SMILES | COc1ccc(NC(=O)CCO[C@@H]2CCC3C4CCc5cc(OP(=O)(OC(C)(C)C)OC(C)(C)C)ccc5C4CC[C@]32C)c(O)c1C(N)=O |
| InChI | InChI=1S/C37H53N2O9P/c1-35(2,3)47-49(43,48-36(4,5)6)46-23-10-12-24-22(21-23)9-11-26-25(24)17-19-37(7)27(26)13-16-30(37)45-20-18-31(40)39-28-14-15-29(44-8)32(33(28)41)34(38)42/h10,12,14-15,21,25-27,30,41H,9,11,13,16-20H2,1-8H3,(H2,38,42)(H,39,40)/t25?,26?,27?,30-,37-/m1/s1 |
| InChIKey | BKORIVHLKUTCQJ-FGOQOVEZSA-N |
| XLogP | 7.89 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.81 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|